C24H16ClN3O3 — CID 23397151
N-(1,2-benzoxazol-3-yl)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetamide (PubChem CID 23397151) has the molecular formula C24H16ClN3O3 and a molecular weight of 429.86 g/mol. Its IUPAC name is N-(1,2-benzoxazol-3-yl)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetamide.
| Compound Name | N-(1,2-benzoxazol-3-yl)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 23397151 |
| Molecular Formula | C24H16ClN3O3 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | N-(1,2-benzoxazol-3-yl)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetamide |
| SMILES | O=C(Nc1noc2ccccc12)C(=O)c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H16ClN3O3/c25-16-11-9-15(10-12-16)13-28-14-19(17-5-1-3-7-20(17)28)22(29)24(30)26-23-18-6-2-4-8-21(18)31-27-23/h1-12,14H,13H2,(H,26,27,30) |
| InChIKey | CNRATIYZPRKKDK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|