C23H16BrFN2O2 — CID 46227998
N-(4-bromophenyl)-2-[1-[(4-fluorophenyl)methyl]indol-3-yl]-2-oxoacetamide (PubChem CID 46227998) has the molecular formula C23H16BrFN2O2 and a molecular weight of 451.30 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[1-[(4-fluorophenyl)methyl]indol-3-yl]-2-oxoacetamide.
| Compound Name | N-(4-bromophenyl)-2-[1-[(4-fluorophenyl)methyl]indol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 46227998 |
| Molecular Formula | C23H16BrFN2O2 |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | N-(4-bromophenyl)-2-[1-[(4-fluorophenyl)methyl]indol-3-yl]-2-oxoacetamide |
| SMILES | O=C(Nc1ccc(Br)cc1)C(=O)c1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C23H16BrFN2O2/c24-16-7-11-18(12-8-16)26-23(29)22(28)20-14-27(21-4-2-1-3-19(20)21)13-15-5-9-17(25)10-6-15/h1-12,14H,13H2,(H,26,29) |
| InChIKey | WAOYFGDPCHQLRH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|