C16H13BrN2O — CID 91690104
1-[(4-bromophenyl)methyl]indole-3-carboxamide (PubChem CID 91690104) has the molecular formula C16H13BrN2O and a molecular weight of 329.20 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]indole-3-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 91690104 |
| Molecular Formula | C16H13BrN2O |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]indole-3-carboxamide |
| SMILES | NC(=O)c1cn(Cc2ccc(Br)cc2)c2ccccc12 |
| InChI | InChI=1S/C16H13BrN2O/c17-12-7-5-11(6-8-12)9-19-10-14(16(18)20)13-3-1-2-4-15(13)19/h1-8,10H,9H2,(H2,18,20) |
| InChIKey | NCPWKGYBQZBBPL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |