C23H17BrN2O3 — CID 172864246
2-[[1-[(4-bromophenyl)methyl]indole-3-carbonyl]amino]benzoic acid (PubChem CID 172864246) has the molecular formula C23H17BrN2O3 and a molecular weight of 449.30 g/mol. Its IUPAC name is 2-[[1-[(4-bromophenyl)methyl]indole-3-carbonyl]amino]benzoic acid.
| Compound Name | 2-[[1-[(4-bromophenyl)methyl]indole-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 172864246 |
| Molecular Formula | C23H17BrN2O3 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 2-[[1-[(4-bromophenyl)methyl]indole-3-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=O)c1cn(Cc2ccc(Br)cc2)c2ccccc12 |
| InChI | InChI=1S/C23H17BrN2O3/c24-16-11-9-15(10-12-16)13-26-14-19(17-5-2-4-8-21(17)26)22(27)25-20-7-3-1-6-18(20)23(28)29/h1-12,14H,13H2,(H,25,27)(H,28,29) |
| InChIKey | ZTRCITOPUZOWAM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |