C19H18N4O3 — CID 31404077
2-[(1-benzylindole-3-carbonyl)amino]propanediamide (PubChem CID 31404077) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-[(1-benzylindole-3-carbonyl)amino]propanediamide.
| Compound Name | 2-[(1-benzylindole-3-carbonyl)amino]propanediamide |
|---|---|
| PubChem CID | 31404077 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[(1-benzylindole-3-carbonyl)amino]propanediamide |
| SMILES | NC(=O)C(NC(=O)c1cn(Cc2ccccc2)c2ccccc12)C(N)=O |
| InChI | InChI=1S/C19H18N4O3/c20-17(24)16(18(21)25)22-19(26)14-11-23(10-12-6-2-1-3-7-12)15-9-5-4-8-13(14)15/h1-9,11,16H,10H2,(H2,20,24)(H2,21,25)(H,22,26) |
| InChIKey | LNSFYTPXTITANT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|