C23H18BrN3O2 — CID 26718991
1-benzyl-N'-(2-bromobenzoyl)indole-3-carbohydrazide (PubChem CID 26718991) has the molecular formula C23H18BrN3O2 and a molecular weight of 448.32 g/mol. Its IUPAC name is 1-benzyl-N'-(2-bromobenzoyl)indole-3-carbohydrazide.
| Compound Name | 1-benzyl-N'-(2-bromobenzoyl)indole-3-carbohydrazide |
|---|---|
| PubChem CID | 26718991 |
| Molecular Formula | C23H18BrN3O2 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 1-benzyl-N'-(2-bromobenzoyl)indole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cn(Cc2ccccc2)c2ccccc12)c1ccccc1Br |
| InChI | InChI=1S/C23H18BrN3O2/c24-20-12-6-4-11-18(20)22(28)25-26-23(29)19-15-27(14-16-8-2-1-3-9-16)21-13-7-5-10-17(19)21/h1-13,15H,14H2,(H,25,28)(H,26,29) |
| InChIKey | FSGLXAVQGSOFQI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|