C25H23N3O3 — CID 174999219
1-[[4-(hydroxycarbamoyl)phenyl]methyl]-N-(2-phenylethyl)indole-3-carboxamide (PubChem CID 174999219) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 1-[[4-(hydroxycarbamoyl)phenyl]methyl]-N-(2-phenylethyl)indole-3-carboxamide.
| Compound Name | 1-[[4-(hydroxycarbamoyl)phenyl]methyl]-N-(2-phenylethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 174999219 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-[[4-(hydroxycarbamoyl)phenyl]methyl]-N-(2-phenylethyl)indole-3-carboxamide |
| SMILES | O=C(NO)c1ccc(Cn2cc(C(=O)NCCc3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H23N3O3/c29-24(27-31)20-12-10-19(11-13-20)16-28-17-22(21-8-4-5-9-23(21)28)25(30)26-15-14-18-6-2-1-3-7-18/h1-13,17,31H,14-16H2,(H,26,30)(H,27,29) |
| InChIKey | CJJBBNKOTYWYRI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|