C25H20ClF3N2O — CID 166984640
1-[(4-chlorophenyl)methyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]indole-3-carboxamide (PubChem CID 166984640) has the molecular formula C25H20ClF3N2O and a molecular weight of 456.90 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]indole-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 166984640 |
| Molecular Formula | C25H20ClF3N2O |
| Molecular Weight | 456.90 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]indole-3-carboxamide |
| SMILES | O=C(NCCc1cccc(C(F)(F)F)c1)c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H20ClF3N2O/c26-20-10-8-18(9-11-20)15-31-16-22(21-6-1-2-7-23(21)31)24(32)30-13-12-17-4-3-5-19(14-17)25(27,28)29/h1-11,14,16H,12-13,15H2,(H,30,32) |
| InChIKey | YDKLSLYPYRKBRR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.90 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |