C18H15F3N4O — CID 119060222
2-(1,2,4-triazol-4-yl)-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 119060222) has the molecular formula C18H15F3N4O and a molecular weight of 360.34 g/mol. Its IUPAC name is 2-(1,2,4-triazol-4-yl)-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 2-(1,2,4-triazol-4-yl)-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 119060222 |
| Molecular Formula | C18H15F3N4O |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-(1,2,4-triazol-4-yl)-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | O=C(NCCc1cccc(C(F)(F)F)c1)c1ccccc1-n1cnnc1 |
| InChI | InChI=1S/C18H15F3N4O/c19-18(20,21)14-5-3-4-13(10-14)8-9-22-17(26)15-6-1-2-7-16(15)25-11-23-24-12-25/h1-7,10-12H,8-9H2,(H,22,26) |
| InChIKey | XSWKBQDEFWSMNU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |