C27H19F6NO — CID 57233630
N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-naphthalen-1-ylbenzamide (PubChem CID 57233630) has the molecular formula C27H19F6NO and a molecular weight of 487.44 g/mol. Its IUPAC name is N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-naphthalen-1-ylbenzamide.
| Compound Name | N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-naphthalen-1-ylbenzamide |
|---|---|
| PubChem CID | 57233630 |
| Molecular Formula | C27H19F6NO |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-naphthalen-1-ylbenzamide |
| SMILES | O=C(NCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1-c1cccc2ccccc12 |
| InChI | InChI=1S/C27H19F6NO/c28-26(29,30)19-14-17(15-20(16-19)27(31,32)33)12-13-34-25(35)24-10-4-3-9-23(24)22-11-5-7-18-6-1-2-8-21(18)22/h1-11,14-16H,12-13H2,(H,34,35) |
| InChIKey | OZACHDATYXDCLX-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |