C22H14BrF6NO — CID 54055088
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(2-bromophenyl)benzamide (PubChem CID 54055088) has the molecular formula C22H14BrF6NO and a molecular weight of 502.25 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(2-bromophenyl)benzamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(2-bromophenyl)benzamide |
|---|---|
| PubChem CID | 54055088 |
| Molecular Formula | C22H14BrF6NO |
| Molecular Weight | 502.25 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(2-bromophenyl)benzamide |
| SMILES | O=C(NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1-c1ccccc1Br |
| InChI | InChI=1S/C22H14BrF6NO/c23-19-8-4-3-6-17(19)16-5-1-2-7-18(16)20(31)30-12-13-9-14(21(24,25)26)11-15(10-13)22(27,28)29/h1-11H,12H2,(H,30,31) |
| InChIKey | LVRFKEXDSQPVGZ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.25 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |