C13H13F6NO — CID 153344454
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpropanamide (PubChem CID 153344454) has the molecular formula C13H13F6NO and a molecular weight of 313.24 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpropanamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 153344454 |
| Molecular Formula | C13H13F6NO |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F6NO/c1-7(2)11(21)20-6-8-3-9(12(14,15)16)5-10(4-8)13(17,18)19/h3-5,7H,6H2,1-2H3,(H,20,21) |
| InChIKey | MPKTXGXDTJUHFM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |