C28H26F6N2OSi — CID 90961364
N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-4-(2-methylphenyl)-6-(2-trimethylsilylethynyl)pyridine-3-carboxamide (PubChem CID 90961364) has the molecular formula C28H26F6N2OSi and a molecular weight of 548.60 g/mol. Its IUPAC name is N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-4-(2-methylphenyl)-6-(2-trimethylsilylethynyl)pyridine-3-carboxamide.
| Compound Name | N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-4-(2-methylphenyl)-6-(2-trimethylsilylethynyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90961364 |
| Molecular Formula | C28H26F6N2OSi |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | N-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-4-(2-methylphenyl)-6-(2-trimethylsilylethynyl)pyridine-3-carboxamide |
| SMILES | Cc1ccccc1-c1cc(C#C[Si](C)(C)C)ncc1C(=O)NCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H26F6N2OSi/c1-18-7-5-6-8-23(18)24-16-22(10-12-38(2,3)4)36-17-25(24)26(37)35-11-9-19-13-20(27(29,30)31)15-21(14-19)28(32,33)34/h5-8,13-17H,9,11H2,1-4H3,(H,35,37) |
| InChIKey | HSTZXYBUTDBMQF-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|