C22H15ClF6N2O — CID 123776153
N-[[6-chloro-4-(2-methylphenyl)-3-pyridinyl]methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 123776153) has the molecular formula C22H15ClF6N2O and a molecular weight of 472.82 g/mol. Its IUPAC name is N-[[6-chloro-4-(2-methylphenyl)-3-pyridinyl]methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[[6-chloro-4-(2-methylphenyl)-3-pyridinyl]methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 123776153 |
| Molecular Formula | C22H15ClF6N2O |
| Molecular Weight | 472.82 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | N-[[6-chloro-4-(2-methylphenyl)-3-pyridinyl]methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1ccccc1-c1cc(Cl)ncc1CNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H15ClF6N2O/c1-12-4-2-3-5-17(12)18-9-19(23)30-10-14(18)11-31-20(32)13-6-15(21(24,25)26)8-16(7-13)22(27,28)29/h2-10H,11H2,1H3,(H,31,32) |
| InChIKey | VUQAHXINNNMIAD-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.82 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|