C15H11F6N3O — CID 122263448
N-[(6-methylpyrimidin-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 122263448) has the molecular formula C15H11F6N3O and a molecular weight of 363.26 g/mol. Its IUPAC name is N-[(6-methylpyrimidin-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(6-methylpyrimidin-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 122263448 |
| Molecular Formula | C15H11F6N3O |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N-[(6-methylpyrimidin-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1cc(CNC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ncn1 |
| InChI | InChI=1S/C15H11F6N3O/c1-8-2-12(24-7-23-8)6-22-13(25)9-3-10(14(16,17)18)5-11(4-9)15(19,20)21/h2-5,7H,6H2,1H3,(H,22,25) |
| InChIKey | MCIAIJXKBKGRCE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |