C16H13F6NO2 — CID 90536144
N-[(2,5-dimethylfuran-3-yl)methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 90536144) has the molecular formula C16H13F6NO2 and a molecular weight of 365.27 g/mol. Its IUPAC name is N-[(2,5-dimethylfuran-3-yl)methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(2,5-dimethylfuran-3-yl)methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90536144 |
| Molecular Formula | C16H13F6NO2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-[(2,5-dimethylfuran-3-yl)methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1cc(CNC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(C)o1 |
| InChI | InChI=1S/C16H13F6NO2/c1-8-3-11(9(2)25-8)7-23-14(24)10-4-12(15(17,18)19)6-13(5-10)16(20,21)22/h3-6H,7H2,1-2H3,(H,23,24) |
| InChIKey | UQQRLVRXTSCMGQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |