C19H17F6NO4 — CID 18286098
3,5-bis(trifluoromethyl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide (PubChem CID 18286098) has the molecular formula C19H17F6NO4 and a molecular weight of 437.34 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide.
| Compound Name | 3,5-bis(trifluoromethyl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 18286098 |
| Molecular Formula | C19H17F6NO4 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 3,5-bis(trifluoromethyl)-N-[(2,4,5-trimethoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F6NO4/c1-28-14-8-16(30-3)15(29-2)6-11(14)9-26-17(27)10-4-12(18(20,21)22)7-13(5-10)19(23,24)25/h4-8H,9H2,1-3H3,(H,26,27) |
| InChIKey | KJVLRBAFBMIRIB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |