C21H14F6N2O — CID 141359253
N-[(4-phenyl-3-pyridinyl)methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 141359253) has the molecular formula C21H14F6N2O and a molecular weight of 424.34 g/mol. Its IUPAC name is N-[(4-phenyl-3-pyridinyl)methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(4-phenyl-3-pyridinyl)methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 141359253 |
| Molecular Formula | C21H14F6N2O |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N-[(4-phenyl-3-pyridinyl)methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCc1cnccc1-c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H14F6N2O/c22-20(23,24)16-8-14(9-17(10-16)21(25,26)27)19(30)29-12-15-11-28-7-6-18(15)13-4-2-1-3-5-13/h1-11H,12H2,(H,29,30) |
| InChIKey | QGSYVTPNKFTVPD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |