C23H17FN2O — CID 7439016
3-fluoro-N-[(5-phenylisoquinolin-8-yl)methyl]benzamide (PubChem CID 7439016) has the molecular formula C23H17FN2O and a molecular weight of 356.40 g/mol. Its IUPAC name is 3-fluoro-N-[(5-phenylisoquinolin-8-yl)methyl]benzamide.
| Compound Name | 3-fluoro-N-[(5-phenylisoquinolin-8-yl)methyl]benzamide |
|---|---|
| PubChem CID | 7439016 |
| Molecular Formula | C23H17FN2O |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 3-fluoro-N-[(5-phenylisoquinolin-8-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(-c2ccccc2)c2ccncc12)c1cccc(F)c1 |
| InChI | InChI=1S/C23H17FN2O/c24-19-8-4-7-17(13-19)23(27)26-14-18-9-10-20(16-5-2-1-3-6-16)21-11-12-25-15-22(18)21/h1-13,15H,14H2,(H,26,27) |
| InChIKey | ULMZEBJWNIQEJC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |