C25H23N3O — CID 7362545
1-benzyl-3-[[5-(4-methylphenyl)isoquinolin-8-yl]methyl]urea (PubChem CID 7362545) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-benzyl-3-[[5-(4-methylphenyl)isoquinolin-8-yl]methyl]urea.
| Compound Name | 1-benzyl-3-[[5-(4-methylphenyl)isoquinolin-8-yl]methyl]urea |
|---|---|
| PubChem CID | 7362545 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 1-benzyl-3-[[5-(4-methylphenyl)isoquinolin-8-yl]methyl]urea |
| SMILES | Cc1ccc(-c2ccc(CNC(=O)NCc3ccccc3)c3cnccc23)cc1 |
| InChI | InChI=1S/C25H23N3O/c1-18-7-9-20(10-8-18)22-12-11-21(24-17-26-14-13-23(22)24)16-28-25(29)27-15-19-5-3-2-4-6-19/h2-14,17H,15-16H2,1H3,(H2,27,28,29) |
| InChIKey | JPALTAGKHFMIJE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |