C29H23N3O2 — CID 118916588
N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]-3-phenylpyridine-4-carboxamide (PubChem CID 118916588) has the molecular formula C29H23N3O2 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]-3-phenylpyridine-4-carboxamide.
| Compound Name | N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]-3-phenylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 118916588 |
| Molecular Formula | C29H23N3O2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]-3-phenylpyridine-4-carboxamide |
| SMILES | COc1cccc(-c2ccc(CNC(=O)c3ccncc3-c3ccccc3)c3cnccc23)c1 |
| InChI | InChI=1S/C29H23N3O2/c1-34-23-9-5-8-21(16-23)24-11-10-22(28-19-30-14-12-25(24)28)17-32-29(33)26-13-15-31-18-27(26)20-6-3-2-4-7-20/h2-16,18-19H,17H2,1H3,(H,32,33) |
| InChIKey | OOCJOKDYMPWUTB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |