C26H21F3N2O3 — CID 118916555
N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]-2-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 118916555) has the molecular formula C26H21F3N2O3 and a molecular weight of 466.46 g/mol. Its IUPAC name is N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]-2-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 118916555 |
| Molecular Formula | C26H21F3N2O3 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | COc1cccc(-c2ccc(CNC(=O)Cc3cccc(OC(F)(F)F)c3)c3cnccc23)c1 |
| InChI | InChI=1S/C26H21F3N2O3/c1-33-20-6-3-5-18(14-20)22-9-8-19(24-16-30-11-10-23(22)24)15-31-25(32)13-17-4-2-7-21(12-17)34-26(27,28)29/h2-12,14,16H,13,15H2,1H3,(H,31,32) |
| InChIKey | IZVOSRJEKJKKEA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |