C30H24N2O3 — CID 118928930
4-(2-hydroxyphenyl)-N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]benzamide (PubChem CID 118928930) has the molecular formula C30H24N2O3 and a molecular weight of 460.53 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]benzamide.
| Compound Name | 4-(2-hydroxyphenyl)-N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]benzamide |
|---|---|
| PubChem CID | 118928930 |
| Molecular Formula | C30H24N2O3 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 4-(2-hydroxyphenyl)-N-[[5-(3-methoxyphenyl)isoquinolin-8-yl]methyl]benzamide |
| SMILES | COc1cccc(-c2ccc(CNC(=O)c3ccc(-c4ccccc4O)cc3)c3cnccc23)c1 |
| InChI | InChI=1S/C30H24N2O3/c1-35-24-6-4-5-22(17-24)25-14-13-23(28-19-31-16-15-27(25)28)18-32-30(34)21-11-9-20(10-12-21)26-7-2-3-8-29(26)33/h2-17,19,33H,18H2,1H3,(H,32,34) |
| InChIKey | PXXGHCWTCAOACW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |