C28H25N3O2 — CID 158717342
1-[[4-[2-(2-phenylphenyl)acetyl]phenyl]methyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 158717342) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 1-[[4-[2-(2-phenylphenyl)acetyl]phenyl]methyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[[4-[2-(2-phenylphenyl)acetyl]phenyl]methyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 158717342 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 1-[[4-[2-(2-phenylphenyl)acetyl]phenyl]methyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1ccc(C(=O)Cc2ccccc2-c2ccccc2)cc1)NCc1cccnc1 |
| InChI | InChI=1S/C28H25N3O2/c32-27(17-25-10-4-5-11-26(25)23-8-2-1-3-9-23)24-14-12-21(13-15-24)19-30-28(33)31-20-22-7-6-16-29-18-22/h1-16,18H,17,19-20H2,(H2,30,31,33) |
| InChIKey | IJMAHMMAAXBDFG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |