C27H24N4O2 — CID 140758363
4-[(2-phenylphenyl)methyl-(pyridin-3-ylmethylcarbamoyl)amino]benzamide (PubChem CID 140758363) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 4-[(2-phenylphenyl)methyl-(pyridin-3-ylmethylcarbamoyl)amino]benzamide.
| Compound Name | 4-[(2-phenylphenyl)methyl-(pyridin-3-ylmethylcarbamoyl)amino]benzamide |
|---|---|
| PubChem CID | 140758363 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 4-[(2-phenylphenyl)methyl-(pyridin-3-ylmethylcarbamoyl)amino]benzamide |
| SMILES | NC(=O)c1ccc(N(Cc2ccccc2-c2ccccc2)C(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C27H24N4O2/c28-26(32)22-12-14-24(15-13-22)31(27(33)30-18-20-7-6-16-29-17-20)19-23-10-4-5-11-25(23)21-8-2-1-3-9-21/h1-17H,18-19H2,(H2,28,32)(H,30,33) |
| InChIKey | MGNMIKDRYOTSFU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |