C28H24FN3O2 — CID 46046079
N-benzyl-3-fluoro-N-[4-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]phenyl]benzamide (PubChem CID 46046079) has the molecular formula C28H24FN3O2 and a molecular weight of 453.52 g/mol. Its IUPAC name is N-benzyl-3-fluoro-N-[4-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]phenyl]benzamide.
| Compound Name | N-benzyl-3-fluoro-N-[4-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46046079 |
| Molecular Formula | C28H24FN3O2 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-benzyl-3-fluoro-N-[4-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]phenyl]benzamide |
| SMILES | O=C(Cc1ccc(N(Cc2ccccc2)C(=O)c2cccc(F)c2)cc1)NCc1cccnc1 |
| InChI | InChI=1S/C28H24FN3O2/c29-25-10-4-9-24(17-25)28(34)32(20-22-6-2-1-3-7-22)26-13-11-21(12-14-26)16-27(33)31-19-23-8-5-15-30-18-23/h1-15,17-18H,16,19-20H2,(H,31,33) |
| InChIKey | VBFZKYTZMNDEKT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |