C28H31N3O5 — CID 159196791
hexane-2,5-dione;pyridin-3-ylmethyl N-[[4-[2-(2-aminophenyl)acetyl]phenyl]methyl]carbamate (PubChem CID 159196791) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is hexane-2,5-dione;pyridin-3-ylmethyl N-[[4-[2-(2-aminophenyl)acetyl]phenyl]methyl]carbamate.
| Compound Name | hexane-2,5-dione;pyridin-3-ylmethyl N-[[4-[2-(2-aminophenyl)acetyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 159196791 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | hexane-2,5-dione;pyridin-3-ylmethyl N-[[4-[2-(2-aminophenyl)acetyl]phenyl]methyl]carbamate |
| SMILES | CC(=O)CCC(C)=O.Nc1ccccc1CC(=O)c1ccc(CNC(=O)OCc2cccnc2)cc1 |
| InChI | InChI=1S/C22H21N3O3.C6H10O2/c23-20-6-2-1-5-19(20)12-21(26)18-9-7-16(8-10-18)14-25-22(27)28-15-17-4-3-11-24-13-17;1-5(7)3-4-6(2)8/h1-11,13H,12,14-15,23H2,(H,25,27);3-4H2,1-2H3 |
| InChIKey | KOTLYWBHIOWHMS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|