C24H26N4O3 — CID 142222178
pyridin-3-ylmethyl N-[[4-[3-(2-aminoanilino)-2-methyl-3-oxopropyl]phenyl]methyl]carbamate (PubChem CID 142222178) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-[[4-[3-(2-aminoanilino)-2-methyl-3-oxopropyl]phenyl]methyl]carbamate.
| Compound Name | pyridin-3-ylmethyl N-[[4-[3-(2-aminoanilino)-2-methyl-3-oxopropyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 142222178 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | pyridin-3-ylmethyl N-[[4-[3-(2-aminoanilino)-2-methyl-3-oxopropyl]phenyl]methyl]carbamate |
| SMILES | CC(Cc1ccc(CNC(=O)OCc2cccnc2)cc1)C(=O)Nc1ccccc1N |
| InChI | InChI=1S/C24H26N4O3/c1-17(23(29)28-22-7-3-2-6-21(22)25)13-18-8-10-19(11-9-18)15-27-24(30)31-16-20-5-4-12-26-14-20/h2-12,14,17H,13,15-16,25H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | FCMPOSNKZXDQBH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|