C21H20N4O3 — CID 142789354
pyridin-3-ylmethyl N-[[3-(2-aminophenyl)-4-carbamoylphenyl]methyl]carbamate (PubChem CID 142789354) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-[[3-(2-aminophenyl)-4-carbamoylphenyl]methyl]carbamate.
| Compound Name | pyridin-3-ylmethyl N-[[3-(2-aminophenyl)-4-carbamoylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 142789354 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | pyridin-3-ylmethyl N-[[3-(2-aminophenyl)-4-carbamoylphenyl]methyl]carbamate |
| SMILES | NC(=O)c1ccc(CNC(=O)OCc2cccnc2)cc1-c1ccccc1N |
| InChI | InChI=1S/C21H20N4O3/c22-19-6-2-1-5-16(19)18-10-14(7-8-17(18)20(23)26)12-25-21(27)28-13-15-4-3-9-24-11-15/h1-11H,12-13,22H2,(H2,23,26)(H,25,27) |
| InChIKey | NAARZIYRTRMUDH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|