C25H28N4O3 — CID 156781163
pyridin-3-ylmethyl N-[[4-[[2-(diethylamino)benzoyl]amino]phenyl]methyl]carbamate (PubChem CID 156781163) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-[[4-[[2-(diethylamino)benzoyl]amino]phenyl]methyl]carbamate.
| Compound Name | pyridin-3-ylmethyl N-[[4-[[2-(diethylamino)benzoyl]amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 156781163 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | pyridin-3-ylmethyl N-[[4-[[2-(diethylamino)benzoyl]amino]phenyl]methyl]carbamate |
| SMILES | CCN(CC)c1ccccc1C(=O)Nc1ccc(CNC(=O)OCc2cccnc2)cc1 |
| InChI | InChI=1S/C25H28N4O3/c1-3-29(4-2)23-10-6-5-9-22(23)24(30)28-21-13-11-19(12-14-21)17-27-25(31)32-18-20-8-7-15-26-16-20/h5-16H,3-4,17-18H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | ZUUQAKOVYDJLSE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |