C26H28N4O3 — CID 156781188
pyridin-3-ylmethyl N-[[4-[(2-piperidin-1-ylbenzoyl)amino]phenyl]methyl]carbamate (PubChem CID 156781188) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-[[4-[(2-piperidin-1-ylbenzoyl)amino]phenyl]methyl]carbamate.
| Compound Name | pyridin-3-ylmethyl N-[[4-[(2-piperidin-1-ylbenzoyl)amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 156781188 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | pyridin-3-ylmethyl N-[[4-[(2-piperidin-1-ylbenzoyl)amino]phenyl]methyl]carbamate |
| SMILES | O=C(NCc1ccc(NC(=O)c2ccccc2N2CCCCC2)cc1)OCc1cccnc1 |
| InChI | InChI=1S/C26H28N4O3/c31-25(23-8-2-3-9-24(23)30-15-4-1-5-16-30)29-22-12-10-20(11-13-22)18-28-26(32)33-19-21-7-6-14-27-17-21/h2-3,6-14,17H,1,4-5,15-16,18-19H2,(H,28,32)(H,29,31) |
| InChIKey | UPBSHKDLLSLFTK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |