C35H40N6O6 — CID 42601430
N'-hydroxy-N-phenyloctanediamide;pyridin-3-ylmethyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 42601430) has the molecular formula C35H40N6O6 and a molecular weight of 640.74 g/mol. Its IUPAC name is N'-hydroxy-N-phenyloctanediamide;pyridin-3-ylmethyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate.
| Compound Name | N'-hydroxy-N-phenyloctanediamide;pyridin-3-ylmethyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 42601430 |
| Molecular Formula | C35H40N6O6 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | N'-hydroxy-N-phenyloctanediamide;pyridin-3-ylmethyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNC(=O)OCc2cccnc2)cc1.O=C(CCCCCCC(=O)Nc1ccccc1)NO |
| InChI | InChI=1S/C21H20N4O3.C14H20N2O3/c22-18-5-1-2-6-19(18)25-20(26)17-9-7-15(8-10-17)13-24-21(27)28-14-16-4-3-11-23-12-16;17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h1-12H,13-14,22H2,(H,24,27)(H,25,26);3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18) |
| InChIKey | UPVWSRRJIKYLHN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 184.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|