C24H21N5O — CID 58102011
2-(2-aminophenyl)-1-[4-[[(4-pyridin-3-ylpyrimidin-2-yl)amino]methyl]phenyl]ethanone (PubChem CID 58102011) has the molecular formula C24H21N5O and a molecular weight of 395.47 g/mol. Its IUPAC name is 2-(2-aminophenyl)-1-[4-[[(4-pyridin-3-ylpyrimidin-2-yl)amino]methyl]phenyl]ethanone.
| Compound Name | 2-(2-aminophenyl)-1-[4-[[(4-pyridin-3-ylpyrimidin-2-yl)amino]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 58102011 |
| Molecular Formula | C24H21N5O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-(2-aminophenyl)-1-[4-[[(4-pyridin-3-ylpyrimidin-2-yl)amino]methyl]phenyl]ethanone |
| SMILES | Nc1ccccc1CC(=O)c1ccc(CNc2nccc(-c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C24H21N5O/c25-21-6-2-1-4-19(21)14-23(30)18-9-7-17(8-10-18)15-28-24-27-13-11-22(29-24)20-5-3-12-26-16-20/h1-13,16H,14-15,25H2,(H,27,28,29) |
| InChIKey | NEYROFCUYIVJKH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|