N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid

C15H14N4O4S — CID 14346982

IUPACN-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid
SMILESO=S(=O)(O)O.c1ccc(Nc2nccc(-c3cccnc3)n2)cc1
InChIInChI=1S/C15H12N4.H2O4S/c1-2-6-13(7-3-1)18-15-17-10-8-14(19-15)12-5-4-9-16-11-12;1-5(2,3)4/h1-11H,(H,17,18,19);(H2,1,2,3,4)
InChIKeyRTEXYZILRGJYEP-UHFFFAOYSA-N
MW346.37 g/mol
LogP2.63
Rot. Bonds3

About N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid

N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid (PubChem CID 14346982) has the molecular formula C15H14N4O4S and a molecular weight of 346.37 g/mol. Its IUPAC name is N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid.

Molecular Properties

Compound NameN-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid
PubChem CID14346982
Molecular FormulaC15H14N4O4S
Molecular Weight346.37 g/mol
Exact Mass346.07
IUPAC NameN-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid
SMILESO=S(=O)(O)O.c1ccc(Nc2nccc(-c3cccnc3)n2)cc1
InChIInChI=1S/C15H12N4.H2O4S/c1-2-6-13(7-3-1)18-15-17-10-8-14(19-15)12-5-4-9-16-11-12;1-5(2,3)4/h1-11H,(H,17,18,19);(H2,1,2,3,4)
InChIKeyRTEXYZILRGJYEP-UHFFFAOYSA-N
XLogP2.63
TPSA125.30 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500346.37
LogP ≤ 52.63
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid?
The IUPAC name of N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid (CID 14346982) is N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid.
What is the SMILES notation for N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid?
The canonical SMILES for N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid is O=S(=O)(O)O.c1ccc(Nc2nccc(-c3cccnc3)n2)cc1.
What is the InChIKey of N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid?
The InChIKey is RTEXYZILRGJYEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4.H2O4S/c1-2-6-13(7-3-1)18-15-17-10-8-14(19-15)12-5-4-9-16-11-12;1-5(2,3)4/h1-11H,(H,17,18,19);(H2,1,2,3,4).
What are the key properties of N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid?
N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid has a molecular weight of 346.37 g/mol, XLogP of 2.63, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid is sourced from PubChem (CID 14346982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).