C15H14N4O4S — CID 14346982
N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid (PubChem CID 14346982) has the molecular formula C15H14N4O4S and a molecular weight of 346.37 g/mol. Its IUPAC name is N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid.
| Compound Name | N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid |
|---|---|
| PubChem CID | 14346982 |
| Molecular Formula | C15H14N4O4S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | N-phenyl-4-pyridin-3-ylpyrimidin-2-amine;sulfuric acid |
| SMILES | O=S(=O)(O)O.c1ccc(Nc2nccc(-c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C15H12N4.H2O4S/c1-2-6-13(7-3-1)18-15-17-10-8-14(19-15)12-5-4-9-16-11-12;1-5(2,3)4/h1-11H,(H,17,18,19);(H2,1,2,3,4) |
| InChIKey | RTEXYZILRGJYEP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|