C14H13N5 — CID 104609504
4-(1-methylpyrazol-4-yl)-N-phenylpyrimidin-2-amine (PubChem CID 104609504) has the molecular formula C14H13N5 and a molecular weight of 251.29 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-N-phenylpyrimidin-2-amine.
| Compound Name | 4-(1-methylpyrazol-4-yl)-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 104609504 |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-N-phenylpyrimidin-2-amine |
| SMILES | Cn1cc(-c2ccnc(Nc3ccccc3)n2)cn1 |
| InChI | InChI=1S/C14H13N5/c1-19-10-11(9-16-19)13-7-8-15-14(18-13)17-12-5-3-2-4-6-12/h2-10H,1H3,(H,15,17,18) |
| InChIKey | FJTIIDOBKJDDLG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |