C23H22N6O2S — CID 25212381
N-[4-(dimethylamino)phenyl]-4-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzenesulfonamide (PubChem CID 25212381) has the molecular formula C23H22N6O2S and a molecular weight of 446.54 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-4-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzenesulfonamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-4-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 25212381 |
| Molecular Formula | C23H22N6O2S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-4-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzenesulfonamide |
| SMILES | CN(C)c1ccc(NS(=O)(=O)c2ccc(Nc3nccc(-c4cccnc4)n3)cc2)cc1 |
| InChI | InChI=1S/C23H22N6O2S/c1-29(2)20-9-5-19(6-10-20)28-32(30,31)21-11-7-18(8-12-21)26-23-25-15-13-22(27-23)17-4-3-14-24-16-17/h3-16,28H,1-2H3,(H,25,26,27) |
| InChIKey | CYZUHRBMBZORNH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|