C24H19N7O — CID 44570853
N-(2-aminophenyl)-4-[[[4-(6-cyano-3-pyridinyl)pyrimidin-2-yl]amino]methyl]benzamide (PubChem CID 44570853) has the molecular formula C24H19N7O and a molecular weight of 421.46 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[4-(6-cyano-3-pyridinyl)pyrimidin-2-yl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[4-(6-cyano-3-pyridinyl)pyrimidin-2-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 44570853 |
| Molecular Formula | C24H19N7O |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[4-(6-cyano-3-pyridinyl)pyrimidin-2-yl]amino]methyl]benzamide |
| SMILES | N#Cc1ccc(-c2ccnc(NCc3ccc(C(=O)Nc4ccccc4N)cc3)n2)cn1 |
| InChI | InChI=1S/C24H19N7O/c25-13-19-10-9-18(15-28-19)21-11-12-27-24(31-21)29-14-16-5-7-17(8-6-16)23(32)30-22-4-2-1-3-20(22)26/h1-12,15H,14,26H2,(H,30,32)(H,27,29,31) |
| InChIKey | LEXDNRITRWDWDN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|