C26H23N7O — CID 58930542
N-(2-aminophenyl)-4-[[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-yl]amino]methyl]benzamide (PubChem CID 58930542) has the molecular formula C26H23N7O and a molecular weight of 449.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-yl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 58930542 |
| Molecular Formula | C26H23N7O |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-yl]amino]methyl]benzamide |
| SMILES | Cc1nc2ccccn2c1-c1ccnc(NCc2ccc(C(=O)Nc3ccccc3N)cc2)n1 |
| InChI | InChI=1S/C26H23N7O/c1-17-24(33-15-5-4-8-23(33)30-17)22-13-14-28-26(32-22)29-16-18-9-11-19(12-10-18)25(34)31-21-7-3-2-6-20(21)27/h2-15H,16,27H2,1H3,(H,31,34)(H,28,29,32) |
| InChIKey | BGXOHPVLYIEUCQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 110.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|