C28H27N7O3 — CID 44611113
N-(2-aminophenyl)-4-[[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]pyrimidin-2-yl]amino]benzamide (PubChem CID 44611113) has the molecular formula C28H27N7O3 and a molecular weight of 509.57 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]pyrimidin-2-yl]amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 44611113 |
| Molecular Formula | C28H27N7O3 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]pyrimidin-2-yl]amino]benzamide |
| SMILES | COCCOc1ccc2nc(C)c(-c3ccnc(Nc4ccc(C(=O)Nc5ccccc5N)cc4)n3)n2c1 |
| InChI | InChI=1S/C28H27N7O3/c1-18-26(35-17-21(38-16-15-37-2)11-12-25(35)31-18)24-13-14-30-28(34-24)32-20-9-7-19(8-10-20)27(36)33-23-6-4-3-5-22(23)29/h3-14,17H,15-16,29H2,1-2H3,(H,33,36)(H,30,32,34) |
| InChIKey | VJSQLBKCTGVYBC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 128.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|