C33H32FN7O3 — CID 166068665
N-(2-aminophenyl)-4-[[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]anilino]methyl]benzamide (PubChem CID 166068665) has the molecular formula C33H32FN7O3 and a molecular weight of 593.66 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]anilino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]anilino]methyl]benzamide |
|---|---|
| PubChem CID | 166068665 |
| Molecular Formula | C33H32FN7O3 |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | N-(2-aminophenyl)-4-[[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]anilino]methyl]benzamide |
| SMILES | COCCOc1ccc(Nc2ncc(F)c(Nc3cccc(NCc4ccc(C(=O)Nc5ccccc5N)cc4)c3)n2)cc1 |
| InChI | InChI=1S/C33H32FN7O3/c1-43-17-18-44-27-15-13-24(14-16-27)39-33-37-21-28(34)31(41-33)38-26-6-4-5-25(19-26)36-20-22-9-11-23(12-10-22)32(42)40-30-8-3-2-7-29(30)35/h2-16,19,21,36H,17-18,20,35H2,1H3,(H,40,42)(H2,37,38,39,41) |
| InChIKey | DCFAKRLEOAWCED-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|