C33H38FN7O4 — CID 166068666
N'-(2-aminophenyl)-N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]octanediamide (PubChem CID 166068666) has the molecular formula C33H38FN7O4 and a molecular weight of 615.71 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]octanediamide |
|---|---|
| PubChem CID | 166068666 |
| Molecular Formula | C33H38FN7O4 |
| Molecular Weight | 615.71 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]octanediamide |
| SMILES | COCCOc1ccc(Nc2ncc(F)c(Nc3cccc(NC(=O)CCCCCCC(=O)Nc4ccccc4N)c3)n2)cc1 |
| InChI | InChI=1S/C33H38FN7O4/c1-44-19-20-45-26-17-15-23(16-18-26)39-33-36-22-27(34)32(41-33)38-25-10-8-9-24(21-25)37-30(42)13-4-2-3-5-14-31(43)40-29-12-7-6-11-28(29)35/h6-12,15-18,21-22H,2-5,13-14,19-20,35H2,1H3,(H,37,42)(H,40,43)(H2,36,38,39,41) |
| InChIKey | LXEHRBLVJYSPPG-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.71 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|