C29H38FN7O5 — CID 175533155
N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]-1-[4-hydroxy-4-(hydroxyamino)butyl]piperidine-4-carboxamide (PubChem CID 175533155) has the molecular formula C29H38FN7O5 and a molecular weight of 583.67 g/mol. Its IUPAC name is N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]-1-[4-hydroxy-4-(hydroxyamino)butyl]piperidine-4-carboxamide.
| Compound Name | N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]-1-[4-hydroxy-4-(hydroxyamino)butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 175533155 |
| Molecular Formula | C29H38FN7O5 |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]-1-[4-hydroxy-4-(hydroxyamino)butyl]piperidine-4-carboxamide |
| SMILES | COCCOc1ccc(Nc2ncc(F)c(Nc3cccc(NC(=O)C4CCN(CCCC(O)NO)CC4)c3)n2)cc1 |
| InChI | InChI=1S/C29H38FN7O5/c1-41-16-17-42-24-9-7-21(8-10-24)34-29-31-19-25(30)27(35-29)32-22-4-2-5-23(18-22)33-28(39)20-11-14-37(15-12-20)13-3-6-26(38)36-40/h2,4-5,7-10,18-20,26,36,38,40H,3,6,11-17H2,1H3,(H,33,39)(H2,31,32,34,35) |
| InChIKey | ORSZAODPPRDSJD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 153.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|