C22H23N3O — CID 22478639
N-(2-aminophenyl)-4-[(3,5-dimethylanilino)methyl]benzamide (PubChem CID 22478639) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(3,5-dimethylanilino)methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[(3,5-dimethylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 22478639 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[(3,5-dimethylanilino)methyl]benzamide |
| SMILES | Cc1cc(C)cc(NCc2ccc(C(=O)Nc3ccccc3N)cc2)c1 |
| InChI | InChI=1S/C22H23N3O/c1-15-11-16(2)13-19(12-15)24-14-17-7-9-18(10-8-17)22(26)25-21-6-4-3-5-20(21)23/h3-13,24H,14,23H2,1-2H3,(H,25,26) |
| InChIKey | UTXDJDBTPAQYPN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|