C28H22N6O — CID 142222386
N-(2-aminophenyl)-4-[(6H-indolo[3,2-b]quinoxalin-9-ylamino)methyl]benzamide (PubChem CID 142222386) has the molecular formula C28H22N6O and a molecular weight of 458.53 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(6H-indolo[3,2-b]quinoxalin-9-ylamino)methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[(6H-indolo[3,2-b]quinoxalin-9-ylamino)methyl]benzamide |
|---|---|
| PubChem CID | 142222386 |
| Molecular Formula | C28H22N6O |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[(6H-indolo[3,2-b]quinoxalin-9-ylamino)methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNc2ccc3[nH]c4nc5ccccc5nc4c3c2)cc1 |
| InChI | InChI=1S/C28H22N6O/c29-21-5-1-2-6-23(21)34-28(35)18-11-9-17(10-12-18)16-30-19-13-14-22-20(15-19)26-27(32-22)33-25-8-4-3-7-24(25)31-26/h1-15,30H,16,29H2,(H,32,33)(H,34,35) |
| InChIKey | PHXWAOLWZSEVKJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|