C26H26N8O — CID 22478847
4-[[[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)-1,3,5-triazin-2-yl]amino]methyl]-N-(2-aminophenyl)benzamide (PubChem CID 22478847) has the molecular formula C26H26N8O and a molecular weight of 466.55 g/mol. Its IUPAC name is 4-[[[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)-1,3,5-triazin-2-yl]amino]methyl]-N-(2-aminophenyl)benzamide.
| Compound Name | 4-[[[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)-1,3,5-triazin-2-yl]amino]methyl]-N-(2-aminophenyl)benzamide |
|---|---|
| PubChem CID | 22478847 |
| Molecular Formula | C26H26N8O |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 4-[[[4-amino-6-(2,3-dihydro-1H-inden-2-ylamino)-1,3,5-triazin-2-yl]amino]methyl]-N-(2-aminophenyl)benzamide |
| SMILES | Nc1nc(NCc2ccc(C(=O)Nc3ccccc3N)cc2)nc(NC2Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C26H26N8O/c27-21-7-3-4-8-22(21)31-23(35)17-11-9-16(10-12-17)15-29-25-32-24(28)33-26(34-25)30-20-13-18-5-1-2-6-19(18)14-20/h1-12,20H,13-15,27H2,(H,31,35)(H4,28,29,30,32,33,34) |
| InChIKey | WEGZAQQQNAZHTD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 143.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|