C25H27N7O — CID 175008360
N-(2-aminophenyl)-4-[[(4-piperidin-1-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)amino]methyl]benzamide (PubChem CID 175008360) has the molecular formula C25H27N7O and a molecular weight of 441.54 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[(4-piperidin-1-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[(4-piperidin-1-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 175008360 |
| Molecular Formula | C25H27N7O |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | N-(2-aminophenyl)-4-[[(4-piperidin-1-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)amino]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNc2nc(N3CCCCC3)c3cccn3n2)cc1 |
| InChI | InChI=1S/C25H27N7O/c26-20-7-2-3-8-21(20)28-24(33)19-12-10-18(11-13-19)17-27-25-29-23(31-14-4-1-5-15-31)22-9-6-16-32(22)30-25/h2-3,6-13,16H,1,4-5,14-15,17,26H2,(H,27,30)(H,28,33) |
| InChIKey | IFEBBNCVLZXURN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 100.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|