C22H23N4NaO — CID 145473548
sodium;N-(2-aminophenyl)-4-pyrrolidin-1-ylbenzamide;4H-pyridin-4-ide (PubChem CID 145473548) has the molecular formula C22H23N4NaO and a molecular weight of 382.44 g/mol. Its IUPAC name is sodium;N-(2-aminophenyl)-4-pyrrolidin-1-ylbenzamide;4H-pyridin-4-ide.
| Compound Name | sodium;N-(2-aminophenyl)-4-pyrrolidin-1-ylbenzamide;4H-pyridin-4-ide |
|---|---|
| PubChem CID | 145473548 |
| Molecular Formula | C22H23N4NaO |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | sodium;N-(2-aminophenyl)-4-pyrrolidin-1-ylbenzamide;4H-pyridin-4-ide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(N2CCCC2)cc1.[Na+].[c-]1ccncc1 |
| InChI | InChI=1S/C17H19N3O.C5H4N.Na/c18-15-5-1-2-6-16(15)19-17(21)13-7-9-14(10-8-13)20-11-3-4-12-20;1-2-4-6-5-3-1;/h1-2,5-10H,3-4,11-12,18H2,(H,19,21);2-5H;/q;-1;+1 |
| InChIKey | ZFFVHGMZPUWIEU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|