C17H20N4O2 — CID 10662925
(1-pyridin-4-ylpiperidin-4-yl) N-(2-aminophenyl)carbamate (PubChem CID 10662925) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is (1-pyridin-4-ylpiperidin-4-yl) N-(2-aminophenyl)carbamate.
| Compound Name | (1-pyridin-4-ylpiperidin-4-yl) N-(2-aminophenyl)carbamate |
|---|---|
| PubChem CID | 10662925 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (1-pyridin-4-ylpiperidin-4-yl) N-(2-aminophenyl)carbamate |
| SMILES | Nc1ccccc1NC(=O)OC1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C17H20N4O2/c18-15-3-1-2-4-16(15)20-17(22)23-14-7-11-21(12-8-14)13-5-9-19-10-6-13/h1-6,9-10,14H,7-8,11-12,18H2,(H,20,22) |
| InChIKey | UUYVMTPZQSDHDW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|