C21H34BrN3O2 — CID 59707180
[1-(9-aminononyl)piperidin-4-yl] N-(2-bromophenyl)carbamate (PubChem CID 59707180) has the molecular formula C21H34BrN3O2 and a molecular weight of 440.43 g/mol. Its IUPAC name is [1-(9-aminononyl)piperidin-4-yl] N-(2-bromophenyl)carbamate.
| Compound Name | [1-(9-aminononyl)piperidin-4-yl] N-(2-bromophenyl)carbamate |
|---|---|
| PubChem CID | 59707180 |
| Molecular Formula | C21H34BrN3O2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | [1-(9-aminononyl)piperidin-4-yl] N-(2-bromophenyl)carbamate |
| SMILES | NCCCCCCCCCN1CCC(OC(=O)Nc2ccccc2Br)CC1 |
| InChI | InChI=1S/C21H34BrN3O2/c22-19-10-6-7-11-20(19)24-21(26)27-18-12-16-25(17-13-18)15-9-5-3-1-2-4-8-14-23/h6-7,10-11,18H,1-5,8-9,12-17,23H2,(H,24,26) |
| InChIKey | BKHLKGKZUAYUSX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|