C34H39N3O4 — CID 59838143
[1-[8-(1,3-dioxoisoindol-2-yl)octyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 59838143) has the molecular formula C34H39N3O4 and a molecular weight of 553.70 g/mol. Its IUPAC name is [1-[8-(1,3-dioxoisoindol-2-yl)octyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[8-(1,3-dioxoisoindol-2-yl)octyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 59838143 |
| Molecular Formula | C34H39N3O4 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | [1-[8-(1,3-dioxoisoindol-2-yl)octyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)OC1CCN(CCCCCCCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C34H39N3O4/c38-32-29-17-8-9-18-30(29)33(39)37(32)23-13-4-2-1-3-12-22-36-24-20-27(21-25-36)41-34(40)35-31-19-11-10-16-28(31)26-14-6-5-7-15-26/h5-11,14-19,27H,1-4,12-13,20-25H2,(H,35,40) |
| InChIKey | YOUOKMXRANLVNJ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|